6533b83afe1ef96bd12a79ab
RESEARCH PRODUCT
Heterometallic 3d−4f Polyoxometalate Derived from the Weakley-Type Dimeric Structure
Santiago ReinosoJosé Ramón Galán-mascaróssubject
Inorganic ChemistryCrystallographyChemistryPolyoxometalateCluster (physics)MoietyPhysical and Theoretical ChemistryType (model theory)Combinatorial chemistrydescription
Polyanion [{Ce(H(2)O)(2)}(2)Mn(2)(B-alpha-GeW(9)O(34))(2)](8-) (1) constitutes the first example of a heterometallic 3d-4f cluster related to the Weakley-type dimeric structure, and it contains an unprecedented Ce(III)(2)Mn(III)(2)O(20) rhomblike moiety displaying dominant Ce(III)-Mn(III) ferromagnetic interactions.
| year | journal | country | edition | language |
|---|---|---|---|---|
| 2009-12-17 | Inorganic Chemistry |