6533b826fe1ef96bd1284696
RESEARCH PRODUCT
Crystal structure of catena-poly[[[(2-ethoxypyrazine-κN)copper(I)]-di-μ2-cyanido] [copper(I)-μ2-cyanido]]
Il'ya A. Gural'skiySofiia V. PartsevskaValerii Y. SirenkoSergey O. MalinkinKateryna V. Terebilenkosubject
crystal structurePyrazineCyanidechemistry.chemical_elementethoxypyrazineCrystal structure010402 general chemistry010403 inorganic & nuclear chemistry01 natural sciencesResearch CommunicationsCoordination complexmetal–organic frameworkchemistry.chemical_compoundAtomGeneral Materials ScienceCoordination geometrychemistry.chemical_classificationCrystallographyethoxypyrazinecyanidesGeneral ChemistryCondensed Matter PhysicsCoppercopper(I)0104 chemical sciencesCrystallographychemistryQD901-999Metal-organic frameworkdescription
The title compound, {[Cu(EtOpz)(CN)2][CuCN]}n, where EtOpz is 2-ethoxypyrazine, is a two-dimensional polymeric copper complex with different coordination environments of the two CuI ions. One Cu atom is coordinated to the 2-ethoxypyrazine molecule and two bridging cyanide ligands, equally disordered over two sites. The second Cu atom is coordinated by two disordered over two sites bridging cyanide groups. Two copper–cyanide chains are connected through Cu⋯Cu contact.
| year | journal | country | edition | language |
|---|---|---|---|---|
| 2019-10-01 | Acta Crystallographica Section E Crystallographic Communications |